C11H13N3OS — CID 115680838
4-[[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]methyl]phenol (PubChem CID 115680838) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-[[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]methyl]phenol.
| Compound Name | 4-[[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115680838 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-[[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]methyl]phenol |
| SMILES | CCc1nsc(NCc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C11H13N3OS/c1-2-10-13-11(16-14-10)12-7-8-3-5-9(15)6-4-8/h3-6,15H,2,7H2,1H3,(H,12,13,14) |
| InChIKey | NARPCRPQGHKUPD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |