C27H35N3O3 — CID 11568611
3-[[5-[2-(1-adamantyl)ethyl]-2-tert-butyl-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 11568611) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 3-[[5-[2-(1-adamantyl)ethyl]-2-tert-butyl-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[5-[2-(1-adamantyl)ethyl]-2-tert-butyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11568611 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 3-[[5-[2-(1-adamantyl)ethyl]-2-tert-butyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | CC(C)(C)c1nc(C(=O)Nc2cccc(C(=O)O)c2)c(CCC23CC4CC(CC(C4)C2)C3)[nH]1 |
| InChI | InChI=1S/C27H35N3O3/c1-26(2,3)25-29-21(7-8-27-13-16-9-17(14-27)11-18(10-16)15-27)22(30-25)23(31)28-20-6-4-5-19(12-20)24(32)33/h4-6,12,16-18H,7-11,13-15H2,1-3H3,(H,28,31)(H,29,30)(H,32,33) |
| InChIKey | HKBYMWFROSMGAG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |