C23H21F2N5O3 — CID 11568677
N-(2,4-difluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 11568677) has the molecular formula C23H21F2N5O3 and a molecular weight of 453.45 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11568677 |
| Molecular Formula | C23H21F2N5O3 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1coc(COc2ccc(CCCCn3ccnn3)cc2)n1 |
| InChI | InChI=1S/C23H21F2N5O3/c24-17-6-9-20(19(25)13-17)28-23(31)21-14-33-22(27-21)15-32-18-7-4-16(5-8-18)3-1-2-11-30-12-10-26-29-30/h4-10,12-14H,1-3,11,15H2,(H,28,31) |
| InChIKey | SAJSKTJDLRBNEQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|