C23H22F5N5O2S2 — CID 11592140
N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazole-2-carboxamide (PubChem CID 11592140) has the molecular formula C23H22F5N5O2S2 and a molecular weight of 559.59 g/mol. Its IUPAC name is N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 11592140 |
| Molecular Formula | C23H22F5N5O2S2 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(F)(F)(F)(F)F)cc1)c1nc(COc2ccc(CCCCn3ccnn3)cc2)cs1 |
| InChI | InChI=1S/C23H22F5N5O2S2/c24-37(25,26,27,28)21-10-6-18(7-11-21)30-22(34)23-31-19(16-36-23)15-35-20-8-4-17(5-9-20)3-1-2-13-33-14-12-29-32-33/h4-12,14,16H,1-3,13,15H2,(H,30,34) |
| InChIKey | ZPFAWGWWTRLUGE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|