C23H21ClFN5O2S — CID 11496780
4-chloro-2-fluoro-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 11496780) has the molecular formula C23H21ClFN5O2S and a molecular weight of 485.97 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-2-fluoro-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 11496780 |
| Molecular Formula | C23H21ClFN5O2S |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 4-chloro-2-fluoro-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(COc2ccc(CCCCn3ccnn3)cc2)cs1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H21ClFN5O2S/c24-17-6-9-20(21(25)13-17)22(31)28-23-27-18(15-33-23)14-32-19-7-4-16(5-8-19)3-1-2-11-30-12-10-26-29-30/h4-10,12-13,15H,1-3,11,14H2,(H,27,28,31) |
| InChIKey | BWRGPVHRCGWEDW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|