C24H22F3N5O2S2 — CID 11713521
N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 11713521) has the molecular formula C24H22F3N5O2S2 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 11713521 |
| Molecular Formula | C24H22F3N5O2S2 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(Nc1nc(COc2ccc(CCCCn3ccnn3)cc2)cs1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F3N5O2S2/c25-24(26,27)36-21-10-6-18(7-11-21)22(33)30-23-29-19(16-35-23)15-34-20-8-4-17(5-9-20)3-1-2-13-32-14-12-28-31-32/h4-12,14,16H,1-3,13,15H2,(H,29,30,33) |
| InChIKey | LEHGOLFNRRXITR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|