C27H31N5O2S — CID 11569411
4-tert-butyl-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 11569411) has the molecular formula C27H31N5O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 11569411 |
| Molecular Formula | C27H31N5O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 4-tert-butyl-N-[4-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2nc(COc3ccc(CCCCn4ccnn4)cc3)cs2)cc1 |
| InChI | InChI=1S/C27H31N5O2S/c1-27(2,3)22-11-9-21(10-12-22)25(33)30-26-29-23(19-35-26)18-34-24-13-7-20(8-14-24)6-4-5-16-32-17-15-28-31-32/h7-15,17,19H,4-6,16,18H2,1-3H3,(H,29,30,33) |
| InChIKey | VJRFBZAHTJNZHH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|