C31H47N3O2 — CID 159327303
1-[(2-methylpropan-2-yl)oxy]-4-pentylbenzene;1-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butyl]triazole (PubChem CID 159327303) has the molecular formula C31H47N3O2 and a molecular weight of 493.74 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-4-pentylbenzene;1-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butyl]triazole.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-4-pentylbenzene;1-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butyl]triazole |
|---|---|
| PubChem CID | 159327303 |
| Molecular Formula | C31H47N3O2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.37 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-4-pentylbenzene;1-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butyl]triazole |
| SMILES | CC(C)(C)Oc1ccc(CCCCn2ccnn2)cc1.CCCCCc1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O.C15H24O/c1-16(2,3)20-15-9-7-14(8-10-15)6-4-5-12-19-13-11-17-18-19;1-5-6-7-8-13-9-11-14(12-10-13)16-15(2,3)4/h7-11,13H,4-6,12H2,1-3H3;9-12H,5-8H2,1-4H3 |
| InChIKey | LENJGBDXLSTTQO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|