C23H22FN5O3 — CID 11683511
N-(4-fluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 11683511) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11683511 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1coc(COc2ccc(CCCCn3ccnn3)cc2)n1 |
| InChI | InChI=1S/C23H22FN5O3/c24-18-6-8-19(9-7-18)26-23(30)21-15-32-22(27-21)16-31-20-10-4-17(5-11-20)3-1-2-13-29-14-12-25-28-29/h4-12,14-15H,1-3,13,16H2,(H,26,30) |
| InChIKey | PPFBALNAYUBDMN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|