C14H21FN2S — CID 115687436
1-[(4-fluoro-3,5-dimethylphenyl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 115687436) has the molecular formula C14H21FN2S and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[(4-fluoro-3,5-dimethylphenyl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(4-fluoro-3,5-dimethylphenyl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 115687436 |
| Molecular Formula | C14H21FN2S |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[(4-fluoro-3,5-dimethylphenyl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | Cc1cc(CNC(=S)NCC(C)C)cc(C)c1F |
| InChI | InChI=1S/C14H21FN2S/c1-9(2)7-16-14(18)17-8-12-5-10(3)13(15)11(4)6-12/h5-6,9H,7-8H2,1-4H3,(H2,16,17,18) |
| InChIKey | CUXIHGDEQNRWEY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|