C17H25N3O — CID 115692303
2-(1-adamantyl)-N-(4-ethyl-1H-pyrazol-5-yl)acetamide (PubChem CID 115692303) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(4-ethyl-1H-pyrazol-5-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(4-ethyl-1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 115692303 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-(1-adamantyl)-N-(4-ethyl-1H-pyrazol-5-yl)acetamide |
| SMILES | CCc1cn[nH]c1NC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H25N3O/c1-2-14-10-18-20-16(14)19-15(21)9-17-6-11-3-12(7-17)5-13(4-11)8-17/h10-13H,2-9H2,1H3,(H2,18,19,20,21) |
| InChIKey | YAFMYFORQGHTSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |