C11H22N2OS — CID 115695171
N-tert-butyl-2,2-dimethylthiomorpholine-4-carboxamide (PubChem CID 115695171) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethylthiomorpholine-4-carboxamide.
| Compound Name | N-tert-butyl-2,2-dimethylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 115695171 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-tert-butyl-2,2-dimethylthiomorpholine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2OS/c1-10(2,3)12-9(14)13-6-7-15-11(4,5)8-13/h6-8H2,1-5H3,(H,12,14) |
| InChIKey | LHMMUXOEXIVLSY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |