C12H19ClN2O — CID 115697912
N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,2-dimethylpropan-1-amine (PubChem CID 115697912) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,2-dimethylpropan-1-amine.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 115697912 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CNCCOc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H19ClN2O/c1-12(2,3)9-14-6-7-16-11-5-4-10(13)8-15-11/h4-5,8,14H,6-7,9H2,1-3H3 |
| InChIKey | PBQCHKUXHWONBM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|