C10H16F3NO2 — CID 115699608
4,4,4-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]butanamide (PubChem CID 115699608) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 115699608 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]butanamide |
| SMILES | C=C(C)COCCNC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2/c1-8(2)7-16-6-5-14-9(15)3-4-10(11,12)13/h1,3-7H2,2H3,(H,14,15) |
| InChIKey | HORZHFUTVYYRPH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|