C11H19N3S — CID 115703209
2-(cyclopropylmethylsulfanyl)-N-[(1-methylpyrazol-3-yl)methyl]ethanamine (PubChem CID 115703209) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfanyl)-N-[(1-methylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | 2-(cyclopropylmethylsulfanyl)-N-[(1-methylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115703209 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(cyclopropylmethylsulfanyl)-N-[(1-methylpyrazol-3-yl)methyl]ethanamine |
| SMILES | Cn1ccc(CNCCSCC2CC2)n1 |
| InChI | InChI=1S/C11H19N3S/c1-14-6-4-11(13-14)8-12-5-7-15-9-10-2-3-10/h4,6,10,12H,2-3,5,7-9H2,1H3 |
| InChIKey | JDNXZVXVUGLZGV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|