About N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine
N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine (PubChem CID 115703292) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine.
Molecular Properties
| Compound Name | N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine |
| PubChem CID | 115703292 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine |
| SMILES | CC(C)c1csc(CNC2CCOCC2)n1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(2)11-8-16-12(14-11)7-13-10-3-5-15-6-4-10/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | XRFSKXKSNSMKCB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine?
The IUPAC name of N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine (CID 115703292) is N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine.
What is the SMILES notation for N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine?
The canonical SMILES for N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine is CC(C)c1csc(CNC2CCOCC2)n1.
What is the InChIKey of N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine?
The InChIKey is XRFSKXKSNSMKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2OS/c1-9(2)11-8-16-12(14-11)7-13-10-3-5-15-6-4-10/h8-10,13H,3-7H2,1-2H3.
What are the key properties of N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine?
N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine has a molecular weight of 240.37 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]oxan-4-amine is sourced from PubChem (CID 115703292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).