C11H18ClNO2S — CID 115707270
2-[2-[1-(5-chlorothiophen-2-yl)propylamino]ethoxy]ethanol (PubChem CID 115707270) has the molecular formula C11H18ClNO2S and a molecular weight of 263.79 g/mol. Its IUPAC name is 2-[2-[1-(5-chlorothiophen-2-yl)propylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[1-(5-chlorothiophen-2-yl)propylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 115707270 |
| Molecular Formula | C11H18ClNO2S |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-[2-[1-(5-chlorothiophen-2-yl)propylamino]ethoxy]ethanol |
| SMILES | CCC(NCCOCCO)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNO2S/c1-2-9(10-3-4-11(12)16-10)13-5-7-15-8-6-14/h3-4,9,13-14H,2,5-8H2,1H3 |
| InChIKey | ALEIOOUOLGXVGN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|