C13H23NO2 — CID 115710576
N-[[5-(methoxymethyl)furan-2-yl]methyl]-3-methylpentan-2-amine (PubChem CID 115710576) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-[[5-(methoxymethyl)furan-2-yl]methyl]-3-methylpentan-2-amine.
| Compound Name | N-[[5-(methoxymethyl)furan-2-yl]methyl]-3-methylpentan-2-amine |
|---|---|
| PubChem CID | 115710576 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-[[5-(methoxymethyl)furan-2-yl]methyl]-3-methylpentan-2-amine |
| SMILES | CCC(C)C(C)NCc1ccc(COC)o1 |
| InChI | InChI=1S/C13H23NO2/c1-5-10(2)11(3)14-8-12-6-7-13(16-12)9-15-4/h6-7,10-11,14H,5,8-9H2,1-4H3 |
| InChIKey | AGJZLMOBDFYPCD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |