C14H25NO — CID 63842434
3-ethyl-N-[(5-ethylfuran-2-yl)methyl]pentan-2-amine (PubChem CID 63842434) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-ethyl-N-[(5-ethylfuran-2-yl)methyl]pentan-2-amine.
| Compound Name | 3-ethyl-N-[(5-ethylfuran-2-yl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 63842434 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3-ethyl-N-[(5-ethylfuran-2-yl)methyl]pentan-2-amine |
| SMILES | CCc1ccc(CNC(C)C(CC)CC)o1 |
| InChI | InChI=1S/C14H25NO/c1-5-12(6-2)11(4)15-10-14-9-8-13(7-3)16-14/h8-9,11-12,15H,5-7,10H2,1-4H3 |
| InChIKey | IGBLUIZOCMGXHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |