C10H17NO3 — CID 65312665
2-[(5-ethylfuran-2-yl)methylamino]propane-1,3-diol (PubChem CID 65312665) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(5-ethylfuran-2-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(5-ethylfuran-2-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65312665 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-[(5-ethylfuran-2-yl)methylamino]propane-1,3-diol |
| SMILES | CCc1ccc(CNC(CO)CO)o1 |
| InChI | InChI=1S/C10H17NO3/c1-2-9-3-4-10(14-9)5-11-8(6-12)7-13/h3-4,8,11-13H,2,5-7H2,1H3 |
| InChIKey | KJEOAQUQZAQZSG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |