C9H16N2OS2 — CID 115711563
3-methylsulfinyl-N-(1,3-thiazol-2-ylmethyl)butan-1-amine (PubChem CID 115711563) has the molecular formula C9H16N2OS2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-methylsulfinyl-N-(1,3-thiazol-2-ylmethyl)butan-1-amine.
| Compound Name | 3-methylsulfinyl-N-(1,3-thiazol-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 115711563 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-methylsulfinyl-N-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| SMILES | CC(CCNCc1nccs1)S(C)=O |
| InChI | InChI=1S/C9H16N2OS2/c1-8(14(2)12)3-4-10-7-9-11-5-6-13-9/h5-6,8,10H,3-4,7H2,1-2H3 |
| InChIKey | TYUHXHIWDGCIMB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|