About 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine
2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine (PubChem CID 61286207) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine |
| PubChem CID | 61286207 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine |
| SMILES | CCCC(C)CNCc1nccs1 |
| InChI | InChI=1S/C10H18N2S/c1-3-4-9(2)7-11-8-10-12-5-6-13-10/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | LNSAKCVENDJGCH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine?
The IUPAC name of 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine (CID 61286207) is 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine.
What is the SMILES notation for 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine?
The canonical SMILES for 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine is CCCC(C)CNCc1nccs1.
What is the InChIKey of 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine?
The InChIKey is LNSAKCVENDJGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-3-4-9(2)7-11-8-10-12-5-6-13-10/h5-6,9,11H,3-4,7-8H2,1-2H3.
What are the key properties of 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine?
2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine has a molecular weight of 198.33 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,3-thiazol-2-ylmethyl)pentan-1-amine is sourced from PubChem (CID 61286207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).