C11H20F2N2S — CID 115714951
1-(2,2-difluoroethyl)-N-(thiolan-3-yl)piperidin-4-amine (PubChem CID 115714951) has the molecular formula C11H20F2N2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-(thiolan-3-yl)piperidin-4-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-(thiolan-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 115714951 |
| Molecular Formula | C11H20F2N2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-(thiolan-3-yl)piperidin-4-amine |
| SMILES | FC(F)CN1CCC(NC2CCSC2)CC1 |
| InChI | InChI=1S/C11H20F2N2S/c12-11(13)7-15-4-1-9(2-5-15)14-10-3-6-16-8-10/h9-11,14H,1-8H2 |
| InChIKey | PWUMCUYPEAEDPO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |