C14H26N2 — CID 115719159
N-(3,3-dimethylbutan-2-yl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 115719159) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 115719159 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(NC(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H26N2/c1-6-9-16-10-7-13(8-11-16)15-12(2)14(3,4)5/h1,12-13,15H,7-11H2,2-5H3 |
| InChIKey | TUKKXAZPRACLBB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|