C16H28N2 — CID 64733626
N-(3,5-dimethylcyclohexyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 64733626) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 64733626 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(NC2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C16H28N2/c1-4-7-18-8-5-15(6-9-18)17-16-11-13(2)10-14(3)12-16/h1,13-17H,5-12H2,2-3H3 |
| InChIKey | DRSHPMADOUMHMI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|