C15H27N3 — CID 81343454
1,2-dimethyl-N-(1-prop-2-ynylpiperidin-4-yl)piperidin-4-amine (PubChem CID 81343454) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 1,2-dimethyl-N-(1-prop-2-ynylpiperidin-4-yl)piperidin-4-amine.
| Compound Name | 1,2-dimethyl-N-(1-prop-2-ynylpiperidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 81343454 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 1,2-dimethyl-N-(1-prop-2-ynylpiperidin-4-yl)piperidin-4-amine |
| SMILES | C#CCN1CCC(NC2CCN(C)C(C)C2)CC1 |
| InChI | InChI=1S/C15H27N3/c1-4-8-18-10-6-14(7-11-18)16-15-5-9-17(3)13(2)12-15/h1,13-16H,5-12H2,2-3H3 |
| InChIKey | AQVPHWRJEXXCDX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|