C12H24N2S — CID 115719869
1,5-dimethyl-N-(thian-4-ylmethyl)pyrrolidin-3-amine (PubChem CID 115719869) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 1,5-dimethyl-N-(thian-4-ylmethyl)pyrrolidin-3-amine.
| Compound Name | 1,5-dimethyl-N-(thian-4-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115719869 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1,5-dimethyl-N-(thian-4-ylmethyl)pyrrolidin-3-amine |
| SMILES | CC1CC(NCC2CCSCC2)CN1C |
| InChI | InChI=1S/C12H24N2S/c1-10-7-12(9-14(10)2)13-8-11-3-5-15-6-4-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | LHHPSCWFMDBXDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |