About N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine
N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine (PubChem CID 83906698) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine.
Analyze N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine?
The IUPAC name of N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine (CID 83906698) is N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine.
What is the SMILES notation for N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine?
The canonical SMILES for N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine is CC1CC(CNC2CC2)CCN1C.
What is the InChIKey of N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine?
The InChIKey is HPFTUJMSOQMFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-9-7-10(5-6-13(9)2)8-12-11-3-4-11/h9-12H,3-8H2,1-2H3.
What are the key properties of N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine?
N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine has a molecular weight of 182.31 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,2-dimethylpiperidin-4-yl)methyl]cyclopropanamine is sourced from PubChem (CID 83906698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).