C16H26N2S — CID 115719880
N,N-dimethyl-4-[1-(thian-4-ylmethylamino)ethyl]aniline (PubChem CID 115719880) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(thian-4-ylmethylamino)ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(thian-4-ylmethylamino)ethyl]aniline |
|---|---|
| PubChem CID | 115719880 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N,N-dimethyl-4-[1-(thian-4-ylmethylamino)ethyl]aniline |
| SMILES | CC(NCC1CCSCC1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H26N2S/c1-13(17-12-14-8-10-19-11-9-14)15-4-6-16(7-5-15)18(2)3/h4-7,13-14,17H,8-12H2,1-3H3 |
| InChIKey | PUMNMHNMGMYLJX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|