C14H29NO — CID 115723360
2,2-dimethyl-5-(3-methylhex-5-en-2-ylamino)pentan-1-ol (PubChem CID 115723360) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylhex-5-en-2-ylamino)pentan-1-ol.
| Compound Name | 2,2-dimethyl-5-(3-methylhex-5-en-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 115723360 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylhex-5-en-2-ylamino)pentan-1-ol |
| SMILES | C=CCC(C)C(C)NCCCC(C)(C)CO |
| InChI | InChI=1S/C14H29NO/c1-6-8-12(2)13(3)15-10-7-9-14(4,5)11-16/h6,12-13,15-16H,1,7-11H2,2-5H3 |
| InChIKey | NMSQVIHJUCDFCC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|