C14H31NO — CID 177180640
ethane;2,4,4-trimethyl-5-(propylamino)hex-5-en-1-ol (PubChem CID 177180640) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;2,4,4-trimethyl-5-(propylamino)hex-5-en-1-ol.
| Compound Name | ethane;2,4,4-trimethyl-5-(propylamino)hex-5-en-1-ol |
|---|---|
| PubChem CID | 177180640 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | ethane;2,4,4-trimethyl-5-(propylamino)hex-5-en-1-ol |
| SMILES | C=C(NCCC)C(C)(C)CC(C)CO.CC |
| InChI | InChI=1S/C12H25NO.C2H6/c1-6-7-13-11(3)12(4,5)8-10(2)9-14;1-2/h10,13-14H,3,6-9H2,1-2,4-5H3;1-2H3 |
| InChIKey | MMABSCYOFJZWRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |