C24H49NO — CID 167513339
5-(4,4,6,6,8,8-hexamethylnon-1-en-2-ylamino)-2,2,4,4-tetramethylpentan-1-ol (PubChem CID 167513339) has the molecular formula C24H49NO and a molecular weight of 367.66 g/mol. Its IUPAC name is 5-(4,4,6,6,8,8-hexamethylnon-1-en-2-ylamino)-2,2,4,4-tetramethylpentan-1-ol.
| Compound Name | 5-(4,4,6,6,8,8-hexamethylnon-1-en-2-ylamino)-2,2,4,4-tetramethylpentan-1-ol |
|---|---|
| PubChem CID | 167513339 |
| Molecular Formula | C24H49NO |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.38 |
| IUPAC Name | 5-(4,4,6,6,8,8-hexamethylnon-1-en-2-ylamino)-2,2,4,4-tetramethylpentan-1-ol |
| SMILES | C=C(CC(C)(C)CC(C)(C)CC(C)(C)C)NCC(C)(C)CC(C)(C)CO |
| InChI | InChI=1S/C24H49NO/c1-19(25-17-23(9,10)16-24(11,12)18-26)13-21(5,6)15-22(7,8)14-20(2,3)4/h25-26H,1,13-18H2,2-12H3 |
| InChIKey | RFZVYJJIWSFIJI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |