C15H22N2O2S2 — CID 115727355
N-(1,4-dithian-2-ylmethyl)-1-(3-nitrophenyl)butan-1-amine (PubChem CID 115727355) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-(3-nitrophenyl)butan-1-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-(3-nitrophenyl)butan-1-amine |
|---|---|
| PubChem CID | 115727355 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-(3-nitrophenyl)butan-1-amine |
| SMILES | CCCC(NCC1CSCCS1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-2-4-15(16-10-14-11-20-7-8-21-14)12-5-3-6-13(9-12)17(18)19/h3,5-6,9,14-16H,2,4,7-8,10-11H2,1H3 |
| InChIKey | LCAVRYHJNIQMPG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|