C18H20F2O — CID 115736615
2-(1-adamantyl)-1-(3,5-difluorophenyl)ethanone (PubChem CID 115736615) has the molecular formula C18H20F2O and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(3,5-difluorophenyl)ethanone.
| Compound Name | 2-(1-adamantyl)-1-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 115736615 |
| Molecular Formula | C18H20F2O |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(1-adamantyl)-1-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H20F2O/c19-15-4-14(5-16(20)6-15)17(21)10-18-7-11-1-12(8-18)3-13(2-11)9-18/h4-6,11-13H,1-3,7-10H2 |
| InChIKey | GZEUNCVFBBOKIH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |