C10H19NO2 — CID 115741726
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methoxypropan-2-amine (PubChem CID 115741726) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methoxypropan-2-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 115741726 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-1-methoxypropan-2-amine |
| SMILES | COCC(C)NCC1=CCCOC1 |
| InChI | InChI=1S/C10H19NO2/c1-9(7-12-2)11-6-10-4-3-5-13-8-10/h4,9,11H,3,5-8H2,1-2H3 |
| InChIKey | DBPJNGGEWCVZNQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|