C11H17NO2 — CID 178095201
(3S)-3-[(3E)-5-methoxyhexa-1,3,5-trien-3-yl]morpholine (PubChem CID 178095201) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (3S)-3-[(3E)-5-methoxyhexa-1,3,5-trien-3-yl]morpholine.
| Compound Name | (3S)-3-[(3E)-5-methoxyhexa-1,3,5-trien-3-yl]morpholine |
|---|---|
| PubChem CID | 178095201 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (3S)-3-[(3E)-5-methoxyhexa-1,3,5-trien-3-yl]morpholine |
| SMILES | C=C/C(=C\C(=C)OC)[C@H]1COCCN1 |
| InChI | InChI=1S/C11H17NO2/c1-4-10(7-9(2)13-3)11-8-14-6-5-12-11/h4,7,11-12H,1-2,5-6,8H2,3H3/b10-7+/t11-/m1/s1 |
| InChIKey | GPEMPSMBYJFLEO-PFEDMVJOSA-N |
| XLogP | 1.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|