C15H31NO — CID 142079041
ethene;1-[(Z)-2-methylidenepent-3-enoxy]-N-propylbutan-2-amine;molecular hydrogen (PubChem CID 142079041) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethene;1-[(Z)-2-methylidenepent-3-enoxy]-N-propylbutan-2-amine;molecular hydrogen.
| Compound Name | ethene;1-[(Z)-2-methylidenepent-3-enoxy]-N-propylbutan-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 142079041 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethene;1-[(Z)-2-methylidenepent-3-enoxy]-N-propylbutan-2-amine;molecular hydrogen |
| SMILES | C=C.C=C(/C=C\C)COCC(CC)NCCC.[H][H] |
| InChI | InChI=1S/C13H25NO.C2H4.H2/c1-5-8-12(4)10-15-11-13(7-3)14-9-6-2;1-2;/h5,8,13-14H,4,6-7,9-11H2,1-3H3;1-2H2;1H/b8-5-;; |
| InChIKey | ASQWLOFFCIIUHM-XTKZWJJBSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|