C11H19NO — CID 143659400
(2S,3E)-3-ethenyl-N-ethyl-2-methoxyhexa-3,5-dien-1-amine (PubChem CID 143659400) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S,3E)-3-ethenyl-N-ethyl-2-methoxyhexa-3,5-dien-1-amine.
| Compound Name | (2S,3E)-3-ethenyl-N-ethyl-2-methoxyhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143659400 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2S,3E)-3-ethenyl-N-ethyl-2-methoxyhexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C)[C@@H](CNCC)OC |
| InChI | InChI=1S/C11H19NO/c1-5-8-10(6-2)11(13-4)9-12-7-3/h5-6,8,11-12H,1-2,7,9H2,3-4H3/b10-8+/t11-/m1/s1 |
| InChIKey | DTQDZMVEMLRZGE-RJCSOLBVSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|