C11H19NO — CID 142607570
2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-N-methylethanamine (PubChem CID 142607570) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-N-methylethanamine.
| Compound Name | 2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 142607570 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-N-methylethanamine |
| SMILES | C=C/C(=C\C=C/C)COCCNC |
| InChI | InChI=1S/C11H19NO/c1-4-6-7-11(5-2)10-13-9-8-12-3/h4-7,12H,2,8-10H2,1,3H3/b6-4-,11-7+ |
| InChIKey | SLODCEOXGLRYRC-WXVRQDIQSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|