C13H23NO — CID 142832245
2-[(Z)-2,5-dimethylidenehept-3-enoxy]-N-ethylethanamine (PubChem CID 142832245) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-[(Z)-2,5-dimethylidenehept-3-enoxy]-N-ethylethanamine.
| Compound Name | 2-[(Z)-2,5-dimethylidenehept-3-enoxy]-N-ethylethanamine |
|---|---|
| PubChem CID | 142832245 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-[(Z)-2,5-dimethylidenehept-3-enoxy]-N-ethylethanamine |
| SMILES | C=C(/C=C\C(=C)COCCNCC)CC |
| InChI | InChI=1S/C13H23NO/c1-5-12(3)7-8-13(4)11-15-10-9-14-6-2/h7-8,14H,3-6,9-11H2,1-2H3/b8-7- |
| InChIKey | SJTWGWDANDFBBQ-FPLPWBNLSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|