C12H23NO — CID 143712106
N,N-dimethyl-2-[(2E)-3-methylpenta-2,4-dienoxy]ethanamine;ethene (PubChem CID 143712106) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2E)-3-methylpenta-2,4-dienoxy]ethanamine;ethene.
| Compound Name | N,N-dimethyl-2-[(2E)-3-methylpenta-2,4-dienoxy]ethanamine;ethene |
|---|---|
| PubChem CID | 143712106 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N,N-dimethyl-2-[(2E)-3-methylpenta-2,4-dienoxy]ethanamine;ethene |
| SMILES | C=C.C=C/C(C)=C/COCCN(C)C |
| InChI | InChI=1S/C10H19NO.C2H4/c1-5-10(2)6-8-12-9-7-11(3)4;1-2/h5-6H,1,7-9H2,2-4H3;1-2H2/b10-6+; |
| InChIKey | GRJLYAVLLRDMQW-AAGWESIMSA-N |
| XLogP | 2.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|