C14H29NO — CID 143804228
N,N-dimethyl-3-[(2Z,4Z)-2-methylhexa-2,4-dienoxy]propan-1-amine;ethane (PubChem CID 143804228) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2Z,4Z)-2-methylhexa-2,4-dienoxy]propan-1-amine;ethane.
| Compound Name | N,N-dimethyl-3-[(2Z,4Z)-2-methylhexa-2,4-dienoxy]propan-1-amine;ethane |
|---|---|
| PubChem CID | 143804228 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,N-dimethyl-3-[(2Z,4Z)-2-methylhexa-2,4-dienoxy]propan-1-amine;ethane |
| SMILES | C/C=C\C=C(\C)COCCCN(C)C.CC |
| InChI | InChI=1S/C12H23NO.C2H6/c1-5-6-8-12(2)11-14-10-7-9-13(3)4;1-2/h5-6,8H,7,9-11H2,1-4H3;1-2H3/b6-5-,12-8-; |
| InChIKey | DOMFHTRWCSGIDB-ZJOSAXLGSA-N |
| XLogP | 3.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|