C10H17NO — CID 143097683
1-[(3Z)-2-methylidenehexa-3,5-dienoxy]propan-2-amine (PubChem CID 143097683) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-[(3Z)-2-methylidenehexa-3,5-dienoxy]propan-2-amine.
| Compound Name | 1-[(3Z)-2-methylidenehexa-3,5-dienoxy]propan-2-amine |
|---|---|
| PubChem CID | 143097683 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-[(3Z)-2-methylidenehexa-3,5-dienoxy]propan-2-amine |
| SMILES | C=C/C=C\C(=C)COCC(C)N |
| InChI | InChI=1S/C10H17NO/c1-4-5-6-9(2)7-12-8-10(3)11/h4-6,10H,1-2,7-8,11H2,3H3/b6-5- |
| InChIKey | SJJANHGKSJFQRK-WAYWQWQTSA-N |
| XLogP | 1.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|