C10H19NO — CID 142144487
(Z,3E)-3-ethylidene-2-methoxyhept-4-en-1-amine (PubChem CID 142144487) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z,3E)-3-ethylidene-2-methoxyhept-4-en-1-amine.
| Compound Name | (Z,3E)-3-ethylidene-2-methoxyhept-4-en-1-amine |
|---|---|
| PubChem CID | 142144487 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (Z,3E)-3-ethylidene-2-methoxyhept-4-en-1-amine |
| SMILES | C/C=C(\C=C/CC)C(CN)OC |
| InChI | InChI=1S/C10H19NO/c1-4-6-7-9(5-2)10(8-11)12-3/h5-7,10H,4,8,11H2,1-3H3/b7-6-,9-5+ |
| InChIKey | HCCOULMFAUQOFB-QRLJIZSYSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|