C15H28N2O — CID 142227873
2-amino-3-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienoxy]propanenitrile;ethane (PubChem CID 142227873) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-amino-3-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienoxy]propanenitrile;ethane.
| Compound Name | 2-amino-3-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienoxy]propanenitrile;ethane |
|---|---|
| PubChem CID | 142227873 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-amino-3-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienoxy]propanenitrile;ethane |
| SMILES | C=C/C=C(/COCC(N)C#N)C(=C)C.CC.CC |
| InChI | InChI=1S/C11H16N2O.2C2H6/c1-4-5-10(9(2)3)7-14-8-11(13)6-12;2*1-2/h4-5,11H,1-2,7-8,13H2,3H3;2*1-2H3/b10-5-;; |
| InChIKey | VIRNXEKYCUKFNK-KGEBAWAISA-N |
| XLogP | 3.59 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|