C13H22N2O — CID 142227852
2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile;propane (PubChem CID 142227852) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile;propane.
| Compound Name | 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile;propane |
|---|---|
| PubChem CID | 142227852 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile;propane |
| SMILES | C=C/C=C(\C=C)COCC(N)C#N.CCC |
| InChI | InChI=1S/C10H14N2O.C3H8/c1-3-5-9(4-2)7-13-8-10(12)6-11;1-3-2/h3-5,10H,1-2,7-8,12H2;3H2,1-2H3/b9-5+; |
| InChIKey | IGSSYBJDGYEELN-SZKNIZGXSA-N |
| XLogP | 2.57 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|