C8H13NO — CID 123874139
6-methoxy-3-methylcyclohexa-2,4-dien-1-amine (PubChem CID 123874139) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 6-methoxy-3-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 6-methoxy-3-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123874139 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 6-methoxy-3-methylcyclohexa-2,4-dien-1-amine |
| SMILES | COC1C=CC(C)=CC1N |
| InChI | InChI=1S/C8H13NO/c1-6-3-4-8(10-2)7(9)5-6/h3-5,7-8H,9H2,1-2H3 |
| InChIKey | GYCQCKSRXWAVKS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |