C16H31NO — CID 142390039
ethane;2-[(2E,4E,6E)-5-ethenylocta-2,4,6-trien-3-yl]oxyethanamine (PubChem CID 142390039) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;2-[(2E,4E,6E)-5-ethenylocta-2,4,6-trien-3-yl]oxyethanamine.
| Compound Name | ethane;2-[(2E,4E,6E)-5-ethenylocta-2,4,6-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 142390039 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;2-[(2E,4E,6E)-5-ethenylocta-2,4,6-trien-3-yl]oxyethanamine |
| SMILES | C=CC(/C=C/C)=C\C(=C/C)OCCN.CC.CC |
| InChI | InChI=1S/C12H19NO.2C2H6/c1-4-7-11(5-2)10-12(6-3)14-9-8-13;2*1-2/h4-7,10H,2,8-9,13H2,1,3H3;2*1-2H3/b7-4+,11-10+,12-6+;; |
| InChIKey | WTSQRLQTTHWXLK-JYYPMVQSSA-N |
| XLogP | 4.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|