C10H16FNO — CID 143904399
(2E,3E)-2-ethylidene-4-(2-fluoroethoxy)hexa-3,5-dien-1-amine (PubChem CID 143904399) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-(2-fluoroethoxy)hexa-3,5-dien-1-amine.
| Compound Name | (2E,3E)-2-ethylidene-4-(2-fluoroethoxy)hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143904399 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-(2-fluoroethoxy)hexa-3,5-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)CN)OCCF |
| InChI | InChI=1S/C10H16FNO/c1-3-9(8-12)7-10(4-2)13-6-5-11/h3-4,7H,2,5-6,8,12H2,1H3/b9-3+,10-7+ |
| InChIKey | CGIRFSGTCKPCFP-NCOOIIRRSA-N |
| XLogP | 1.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|