C8H12FNO — CID 169127401
(2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dien-1-amine (PubChem CID 169127401) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dien-1-amine.
| Compound Name | (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 169127401 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2E)-2-(1-fluoroethenyl)-3-methoxypenta-2,4-dien-1-amine |
| SMILES | C=C/C(OC)=C(/CN)C(=C)F |
| InChI | InChI=1S/C8H12FNO/c1-4-8(11-3)7(5-10)6(2)9/h4H,1-2,5,10H2,3H3/b8-7+ |
| InChIKey | FXZXJDLVLJUFHR-BQYQJAHWSA-N |
| XLogP | 1.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|